C23H30N2O4 — CID 172655794
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone (PubChem CID 172655794) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 172655794 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone |
| SMILES | COc1ccc(-c2ccc(C(=O)N3C[C@H]4C[C@@H](N(C)C)[C@H](OC)C[C@H]4C3)o2)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-24(2)19-11-16-13-25(14-17(16)12-22(19)28-4)23(26)21-10-9-20(29-21)15-5-7-18(27-3)8-6-15/h5-10,16-17,19,22H,11-14H2,1-4H3/t16-,17+,19-,22-/m1/s1 |
| InChIKey | RHGRVWYPZOTAPA-ZRAXVTTISA-N |
| XLogP | 3.38 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |