C19H27F3N2O2 — CID 172670141
(3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 172670141) has the molecular formula C19H27F3N2O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 172670141 |
| Molecular Formula | C19H27F3N2O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[[4-(trifluoromethoxy)phenyl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CO[C@@H]1C[C@H]2CN(Cc3ccc(OC(F)(F)F)cc3)C[C@H]2C[C@H]1N(C)C |
| InChI | InChI=1S/C19H27F3N2O2/c1-23(2)17-8-14-11-24(12-15(14)9-18(17)25-3)10-13-4-6-16(7-5-13)26-19(20,21)22/h4-7,14-15,17-18H,8-12H2,1-3H3/t14-,15+,17-,18-/m1/s1 |
| InChIKey | QCEYBIIRQGDJMT-CYGHRXIMSA-N |
| XLogP | 3.37 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |