C21H35Cl2N3O3 — CID 172912642
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(2-aminoethoxy)-4-methylphenyl]methanone;dihydrochloride (PubChem CID 172912642) has the molecular formula C21H35Cl2N3O3 and a molecular weight of 448.44 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(2-aminoethoxy)-4-methylphenyl]methanone;dihydrochloride.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(2-aminoethoxy)-4-methylphenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 172912642 |
| Molecular Formula | C21H35Cl2N3O3 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[3-(2-aminoethoxy)-4-methylphenyl]methanone;dihydrochloride |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3ccc(C)c(OCCN)c3)C[C@H]2C[C@H]1N(C)C.Cl.Cl |
| InChI | InChI=1S/C21H33N3O3.2ClH/c1-14-5-6-15(10-19(14)27-8-7-22)21(25)24-12-16-9-18(23(2)3)20(26-4)11-17(16)13-24;;/h5-6,10,16-18,20H,7-9,11-13,22H2,1-4H3;2*1H/t16-,17+,18-,20-;;/m1../s1 |
| InChIKey | JCWLPHHQABMSIR-DJLCDRMGSA-N |
| XLogP | 2.60 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |