C24H40N4O6 — CID 172910987
[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(3-aminopropyl)-3-pyridinyl]methanone;acetic acid (PubChem CID 172910987) has the molecular formula C24H40N4O6 and a molecular weight of 480.61 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(3-aminopropyl)-3-pyridinyl]methanone;acetic acid.
| Compound Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(3-aminopropyl)-3-pyridinyl]methanone;acetic acid |
|---|---|
| PubChem CID | 172910987 |
| Molecular Formula | C24H40N4O6 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[5-(3-aminopropyl)-3-pyridinyl]methanone;acetic acid |
| SMILES | CC(=O)O.CC(=O)O.CO[C@@H]1C[C@H]2CN(C(=O)c3cncc(CCCN)c3)C[C@H]2C[C@H]1N(C)C |
| InChI | InChI=1S/C20H32N4O2.2C2H4O2/c1-23(2)18-8-16-12-24(13-17(16)9-19(18)26-3)20(25)15-7-14(5-4-6-21)10-22-11-15;2*1-2(3)4/h7,10-11,16-19H,4-6,8-9,12-13,21H2,1-3H3;2*1H3,(H,3,4)/t16-,17+,18-,19-;;/m1../s1 |
| InChIKey | WEOOZEUHUGLDOO-HIHHIWRVSA-N |
| XLogP | 1.58 |
| TPSA | 146.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |