C22H29N3O3 — CID 172656090
4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-6-methyl-1H-quinolin-2-one (PubChem CID 172656090) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-6-methyl-1H-quinolin-2-one.
| Compound Name | 4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-6-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 172656090 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-[(3aS,5R,6R,7aR)-5-(dimethylamino)-6-methoxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-6-methyl-1H-quinolin-2-one |
| SMILES | CO[C@@H]1C[C@H]2CN(C(=O)c3cc(=O)[nH]c4ccc(C)cc34)C[C@H]2C[C@H]1N(C)C |
| InChI | InChI=1S/C22H29N3O3/c1-13-5-6-18-16(7-13)17(10-21(26)23-18)22(27)25-11-14-8-19(24(2)3)20(28-4)9-15(14)12-25/h5-7,10,14-15,19-20H,8-9,11-12H2,1-4H3,(H,23,26)/t14-,15+,19-,20-/m1/s1 |
| InChIKey | FZRAZEPGFJXERA-HRYATBACSA-N |
| XLogP | 2.26 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |