C24H26N2O4 — CID 45204907
[3-(4-methoxyanilino)piperidin-1-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone (PubChem CID 45204907) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is [3-(4-methoxyanilino)piperidin-1-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone.
| Compound Name | [3-(4-methoxyanilino)piperidin-1-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 45204907 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [3-(4-methoxyanilino)piperidin-1-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone |
| SMILES | COc1ccc(NC2CCCN(C(=O)c3ccc(-c4ccc(OC)cc4)o3)C2)cc1 |
| InChI | InChI=1S/C24H26N2O4/c1-28-20-9-5-17(6-10-20)22-13-14-23(30-22)24(27)26-15-3-4-19(16-26)25-18-7-11-21(29-2)12-8-18/h5-14,19,25H,3-4,15-16H2,1-2H3 |
| InChIKey | NLTCRTIFKMWSPO-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|