C17H22N4O3 — CID 45172660
3-[3-(4-methoxyanilino)piperidine-1-carbonyl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 45172660) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[3-(4-methoxyanilino)piperidine-1-carbonyl]-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-[3-(4-methoxyanilino)piperidine-1-carbonyl]-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 45172660 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-[3-(4-methoxyanilino)piperidine-1-carbonyl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | COc1ccc(NC2CCCN(C(=O)C3=NNC(=O)CC3)C2)cc1 |
| InChI | InChI=1S/C17H22N4O3/c1-24-14-6-4-12(5-7-14)18-13-3-2-10-21(11-13)17(23)15-8-9-16(22)20-19-15/h4-7,13,18H,2-3,8-11H2,1H3,(H,20,22) |
| InChIKey | FABLXJVZGVSNOM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|