C21H23N5O2 — CID 56910760
[3-(4-methoxyanilino)piperidin-1-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 56910760) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is [3-(4-methoxyanilino)piperidin-1-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | [3-(4-methoxyanilino)piperidin-1-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 56910760 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | [3-(4-methoxyanilino)piperidin-1-yl]-[2-(1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | COc1ccc(NC2CCCN(C(=O)c3ccccc3-n3cncn3)C2)cc1 |
| InChI | InChI=1S/C21H23N5O2/c1-28-18-10-8-16(9-11-18)24-17-5-4-12-25(13-17)21(27)19-6-2-3-7-20(19)26-15-22-14-23-26/h2-3,6-11,14-15,17,24H,4-5,12-13H2,1H3 |
| InChIKey | RVQIRTAXEVQRGU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|