C19H23N3O3S — CID 95727361
N-[2-[(3R)-3-(4-methoxyanilino)piperidine-1-carbonyl]thiophen-3-yl]acetamide (PubChem CID 95727361) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[2-[(3R)-3-(4-methoxyanilino)piperidine-1-carbonyl]thiophen-3-yl]acetamide.
| Compound Name | N-[2-[(3R)-3-(4-methoxyanilino)piperidine-1-carbonyl]thiophen-3-yl]acetamide |
|---|---|
| PubChem CID | 95727361 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[2-[(3R)-3-(4-methoxyanilino)piperidine-1-carbonyl]thiophen-3-yl]acetamide |
| SMILES | COc1ccc(N[C@@H]2CCCN(C(=O)c3sccc3NC(C)=O)C2)cc1 |
| InChI | InChI=1S/C19H23N3O3S/c1-13(23)20-17-9-11-26-18(17)19(24)22-10-3-4-15(12-22)21-14-5-7-16(25-2)8-6-14/h5-9,11,15,21H,3-4,10,12H2,1-2H3,(H,20,23)/t15-/m1/s1 |
| InChIKey | FUECLQRYKJQXMB-OAHLLOKOSA-N |
| XLogP | 3.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|