C23H27N3O2 — CID 95722969
(3-ethyl-1H-indol-2-yl)-[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methanone (PubChem CID 95722969) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is (3-ethyl-1H-indol-2-yl)-[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methanone.
| Compound Name | (3-ethyl-1H-indol-2-yl)-[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95722969 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (3-ethyl-1H-indol-2-yl)-[(3R)-3-(4-methoxyanilino)piperidin-1-yl]methanone |
| SMILES | CCc1c(C(=O)N2CCC[C@@H](Nc3ccc(OC)cc3)C2)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H27N3O2/c1-3-19-20-8-4-5-9-21(20)25-22(19)23(27)26-14-6-7-17(15-26)24-16-10-12-18(28-2)13-11-16/h4-5,8-13,17,24-25H,3,6-7,14-15H2,1-2H3/t17-/m1/s1 |
| InChIKey | HMPDYWDDTNQPFZ-QGZVFWFLSA-N |
| XLogP | 4.46 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|