C22H31N3O2 — CID 124749836
(3-ethyl-1H-indol-2-yl)-[(2R)-2-(piperidin-1-ylmethyl)-1,4-oxazepan-4-yl]methanone (PubChem CID 124749836) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is (3-ethyl-1H-indol-2-yl)-[(2R)-2-(piperidin-1-ylmethyl)-1,4-oxazepan-4-yl]methanone.
| Compound Name | (3-ethyl-1H-indol-2-yl)-[(2R)-2-(piperidin-1-ylmethyl)-1,4-oxazepan-4-yl]methanone |
|---|---|
| PubChem CID | 124749836 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (3-ethyl-1H-indol-2-yl)-[(2R)-2-(piperidin-1-ylmethyl)-1,4-oxazepan-4-yl]methanone |
| SMILES | CCc1c(C(=O)N2CCCO[C@H](CN3CCCCC3)C2)[nH]c2ccccc12 |
| InChI | InChI=1S/C22H31N3O2/c1-2-18-19-9-4-5-10-20(19)23-21(18)22(26)25-13-8-14-27-17(16-25)15-24-11-6-3-7-12-24/h4-5,9-10,17,23H,2-3,6-8,11-16H2,1H3/t17-/m1/s1 |
| InChIKey | BMEQYVWTLPLLFW-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|