C19H22N2O3 — CID 70706506
[(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone (PubChem CID 70706506) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is [(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone.
| Compound Name | [(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 70706506 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | [(3aS,6aS)-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-[5-(4-methoxyphenyl)furan-2-yl]methanone |
| SMILES | COc1ccc(-c2ccc(C(=O)N3C[C@@H]4CCN(C)[C@@H]4C3)o2)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-20-10-9-14-11-21(12-16(14)20)19(22)18-8-7-17(24-18)13-3-5-15(23-2)6-4-13/h3-8,14,16H,9-12H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | QVGCDCQFZDKYBG-GOEBONIOSA-N |
| XLogP | 2.73 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |