C24H24N2O4 — CID 42274003
(6S)-4-[5-(4-methoxyphenyl)furan-2-carbonyl]-6-methyl-1-(2-methylphenyl)piperazin-2-one (PubChem CID 42274003) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is (6S)-4-[5-(4-methoxyphenyl)furan-2-carbonyl]-6-methyl-1-(2-methylphenyl)piperazin-2-one.
| Compound Name | (6S)-4-[5-(4-methoxyphenyl)furan-2-carbonyl]-6-methyl-1-(2-methylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 42274003 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (6S)-4-[5-(4-methoxyphenyl)furan-2-carbonyl]-6-methyl-1-(2-methylphenyl)piperazin-2-one |
| SMILES | COc1ccc(-c2ccc(C(=O)N3CC(=O)N(c4ccccc4C)[C@@H](C)C3)o2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-16-6-4-5-7-20(16)26-17(2)14-25(15-23(26)27)24(28)22-13-12-21(30-22)18-8-10-19(29-3)11-9-18/h4-13,17H,14-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | ZUCPOTFOROTCBE-KRWDZBQOSA-N |
| XLogP | 4.14 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |