C18H28N2O4S — CID 172660210
(3aS,5R,6R,7aR)-6-methoxy-2-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 172660210) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-6-methoxy-2-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aS,5R,6R,7aR)-6-methoxy-2-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 172660210 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | (3aS,5R,6R,7aR)-6-methoxy-2-(4-methoxyphenyl)sulfonyl-N,N-dimethyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@H]3C[C@@H](N(C)C)[C@H](OC)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H28N2O4S/c1-19(2)17-9-13-11-20(12-14(13)10-18(17)24-4)25(21,22)16-7-5-15(23-3)6-8-16/h5-8,13-14,17-18H,9-12H2,1-4H3/t13-,14+,17-,18-/m1/s1 |
| InChIKey | JNLAYANYNULSHT-LTCOOKNTSA-N |
| XLogP | 1.67 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |