C18H25F3N2O3S — CID 172661403
(3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine (PubChem CID 172661403) has the molecular formula C18H25F3N2O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine.
| Compound Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
|---|---|
| PubChem CID | 172661403 |
| Molecular Formula | C18H25F3N2O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (3aS,5R,6R,7aR)-6-methoxy-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-amine |
| SMILES | CO[C@@H]1C[C@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)C[C@H]2C[C@H]1N(C)C |
| InChI | InChI=1S/C18H25F3N2O3S/c1-22(2)16-8-12-10-23(11-13(12)9-17(16)26-3)27(24,25)15-6-4-14(5-7-15)18(19,20)21/h4-7,12-13,16-17H,8-11H2,1-3H3/t12-,13+,16-,17-/m1/s1 |
| InChIKey | SUSOLLOFJYPTHR-DLTLXFJOSA-N |
| XLogP | 2.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |