C10H14N2O3S2 — CID 110737130
N-[(1-methyl-5-oxopyrrolidin-3-yl)methyl]thiophene-2-sulfonamide (PubChem CID 110737130) has the molecular formula C10H14N2O3S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[(1-methyl-5-oxopyrrolidin-3-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1-methyl-5-oxopyrrolidin-3-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110737130 |
| Molecular Formula | C10H14N2O3S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-[(1-methyl-5-oxopyrrolidin-3-yl)methyl]thiophene-2-sulfonamide |
| SMILES | CN1CC(CNS(=O)(=O)c2cccs2)CC1=O |
| InChI | InChI=1S/C10H14N2O3S2/c1-12-7-8(5-9(12)13)6-11-17(14,15)10-3-2-4-16-10/h2-4,8,11H,5-7H2,1H3 |
| InChIKey | WKSCQMKURXLYOB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |