C14H20N4O2S2 — CID 56760043
N-[[1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide (PubChem CID 56760043) has the molecular formula C14H20N4O2S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[[1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56760043 |
| Molecular Formula | C14H20N4O2S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[[1-[(1-methylpyrazol-4-yl)methyl]pyrrolidin-3-yl]methyl]thiophene-2-sulfonamide |
| SMILES | Cn1cc(CN2CCC(CNS(=O)(=O)c3cccs3)C2)cn1 |
| InChI | InChI=1S/C14H20N4O2S2/c1-17-9-13(7-15-17)11-18-5-4-12(10-18)8-16-22(19,20)14-3-2-6-21-14/h2-3,6-7,9,12,16H,4-5,8,10-11H2,1H3 |
| InChIKey | BMMAYAYJEGLZEQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |