C7H10N4O2S2 — CID 2826112
(4-sulfamoylanilino)thiourea (PubChem CID 2826112) has the molecular formula C7H10N4O2S2 and a molecular weight of 246.32 g/mol. Its IUPAC name is (4-sulfamoylanilino)thiourea.
| Compound Name | (4-sulfamoylanilino)thiourea |
|---|---|
| PubChem CID | 2826112 |
| Molecular Formula | C7H10N4O2S2 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | (4-sulfamoylanilino)thiourea |
| SMILES | NC(=S)NNc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H10N4O2S2/c8-7(14)11-10-5-1-3-6(4-2-5)15(9,12)13/h1-4,10H,(H3,8,11,14)(H2,9,12,13) |
| InChIKey | VPFNITBWKKKRLL-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|