About (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride
(2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride (PubChem CID 160795299) has the molecular formula C10H17Cl3N4O2S
and a molecular weight of 363.70 g/mol. Its IUPAC name is (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride.
Molecular Properties
| Compound Name | (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride |
| PubChem CID | 160795299 |
| Molecular Formula | C10H17Cl3N4O2S |
| Molecular Weight | 363.70 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride |
| SMILES | C[C@H](Nc1ccc(NNC(N)=S)cc1)C(=O)O.Cl.Cl.Cl |
| InChI | InChI=1S/C10H14N4O2S.3ClH/c1-6(9(15)16)12-7-2-4-8(5-3-7)13-14-10(11)17;;;/h2-6,12-13H,1H3,(H,15,16)(H3,11,14,17);3*1H/t6-;;;/m0.../s1 |
| InChIKey | SCJAXQKODCVULQ-GSUNZCPGSA-N |
| XLogP | 2.00 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.70 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride?
The IUPAC name of (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride (CID 160795299) is (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride.
What is the SMILES notation for (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride?
The canonical SMILES for (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride is C[C@H](Nc1ccc(NNC(N)=S)cc1)C(=O)O.Cl.Cl.Cl.
What is the InChIKey of (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride?
The InChIKey is SCJAXQKODCVULQ-GSUNZCPGSA-N. The full InChI is InChI=1S/C10H14N4O2S.3ClH/c1-6(9(15)16)12-7-2-4-8(5-3-7)13-14-10(11)17;;;/h2-6,12-13H,1H3,(H,15,16)(H3,11,14,17);3*1H/t6-;;;/m0.../s1.
What are the key properties of (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride?
(2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride has a molecular weight of 363.70 g/mol, XLogP of 2.00, 5 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-(2-carbamothioylhydrazinyl)anilino]propanoic acid;trihydrochloride is sourced from PubChem (CID 160795299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).