C4H9ClN2O2S — CID 141048433
2-(carbamothioylamino)propanoic acid;hydrochloride (PubChem CID 141048433) has the molecular formula C4H9ClN2O2S and a molecular weight of 184.65 g/mol. Its IUPAC name is 2-(carbamothioylamino)propanoic acid;hydrochloride.
| Compound Name | 2-(carbamothioylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 141048433 |
| Molecular Formula | C4H9ClN2O2S |
| Molecular Weight | 184.65 g/mol |
| Exact Mass | 184.01 |
| IUPAC Name | 2-(carbamothioylamino)propanoic acid;hydrochloride |
| SMILES | CC(NC(N)=S)C(=O)O.Cl |
| InChI | InChI=1S/C4H8N2O2S.ClH/c1-2(3(7)8)6-4(5)9;/h2H,1H3,(H,7,8)(H3,5,6,9);1H |
| InChIKey | XOUPOYBDZLTTKO-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.65 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|