C6H11N2O3- — CID 58797895
2-amino-1-(1-carboxyethylamino)prop-1-en-1-olate (PubChem CID 58797895) has the molecular formula C6H11N2O3- and a molecular weight of 159.16 g/mol. Its IUPAC name is 2-amino-1-(1-carboxyethylamino)prop-1-en-1-olate.
| Compound Name | 2-amino-1-(1-carboxyethylamino)prop-1-en-1-olate |
|---|---|
| PubChem CID | 58797895 |
| Molecular Formula | C6H11N2O3- |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2-amino-1-(1-carboxyethylamino)prop-1-en-1-olate |
| SMILES | CC(N)=C([O-])NC(C)C(=O)O |
| InChI | InChI=1S/C6H12N2O3/c1-3(7)5(9)8-4(2)6(10)11/h4,8-9H,7H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | JTGXGRXFSKKFAK-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|