C8H13N2NaO4 — CID 101221632
sodium N-[(2R)-1-[[(1S)-1-carboxyethyl]amino]-1-oxopropan-2-yl]ethanimidate (PubChem CID 101221632) has the molecular formula C8H13N2NaO4 and a molecular weight of 224.19 g/mol. Its IUPAC name is sodium N-[(2R)-1-[[(1S)-1-carboxyethyl]amino]-1-oxopropan-2-yl]ethanimidate.
| Compound Name | sodium N-[(2R)-1-[[(1S)-1-carboxyethyl]amino]-1-oxopropan-2-yl]ethanimidate |
|---|---|
| PubChem CID | 101221632 |
| Molecular Formula | C8H13N2NaO4 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | sodium N-[(2R)-1-[[(1S)-1-carboxyethyl]amino]-1-oxopropan-2-yl]ethanimidate |
| SMILES | C/C([O-])=N\[C@H](C)C(=O)N[C@@H](C)C(=O)O.[Na+] |
| InChI | InChI=1S/C8H14N2O4.Na/c1-4(9-6(3)11)7(12)10-5(2)8(13)14;/h4-5H,1-3H3,(H,9,11)(H,10,12)(H,13,14);/q;+1/p-1/t4-,5+;/m1./s1 |
| InChIKey | GXAGYBMZIIJOOM-JBUOLDKXSA-M |
| XLogP | -4.25 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|