C9H15NO5 — CID 103498098
4-(1-carboxyethylamino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103498098) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-(1-carboxyethylamino)-2,3-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(1-carboxyethylamino)-2,3-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 103498098 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 4-(1-carboxyethylamino)-2,3-dimethyl-4-oxobutanoic acid |
| SMILES | CC(NC(=O)C(C)C(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15NO5/c1-4(5(2)8(12)13)7(11)10-6(3)9(14)15/h4-6H,1-3H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | PWJVWPQBFQERGE-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |