C7H10N2O3 — CID 101154196
(2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoic acid (PubChem CID 101154196) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 101154196 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | (2S)-2-[[(2S)-2-isocyanopropanoyl]amino]propanoic acid |
| SMILES | [C-]#[N+][C@@H](C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C7H10N2O3/c1-4(8-3)6(10)9-5(2)7(11)12/h4-5H,1-2H3,(H,9,10)(H,11,12)/t4-,5-/m0/s1 |
| InChIKey | NCJDRRIAKBQQAE-WHFBIAKZSA-N |
| XLogP | -0.12 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|