C6H10BrNO3 — CID 6933164
(2S)-2-[[(2S)-2-bromopropanoyl]amino]propanoic acid (PubChem CID 6933164) has the molecular formula C6H10BrNO3 and a molecular weight of 224.05 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-bromopropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-bromopropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 6933164 |
| Molecular Formula | C6H10BrNO3 |
| Molecular Weight | 224.05 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | (2S)-2-[[(2S)-2-bromopropanoyl]amino]propanoic acid |
| SMILES | C[C@H](Br)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C6H10BrNO3/c1-3(7)5(9)8-4(2)6(10)11/h3-4H,1-2H3,(H,8,9)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | ADQOGAQFIJCUCU-IMJSIDKUSA-N |
| XLogP | 0.36 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.05 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|