C13H9F5N4O2S2 — CID 11441308
1-(2,3,4,5,6-pentafluoroanilino)-3-(4-sulfamoylphenyl)thiourea (PubChem CID 11441308) has the molecular formula C13H9F5N4O2S2 and a molecular weight of 412.37 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluoroanilino)-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-(2,3,4,5,6-pentafluoroanilino)-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 11441308 |
| Molecular Formula | C13H9F5N4O2S2 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluoroanilino)-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NNc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H9F5N4O2S2/c14-7-8(15)10(17)12(11(18)9(7)16)21-22-13(25)20-5-1-3-6(4-2-5)26(19,23)24/h1-4,21H,(H2,19,23,24)(H2,20,22,25) |
| InChIKey | VPQCNGWOFGWYOE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|