C13H8F5N3O3S2 — CID 89416726
[4-[(2,3,4,5,6-pentafluorophenyl)carbamothioylamino]phenyl]sulfamic acid (PubChem CID 89416726) has the molecular formula C13H8F5N3O3S2 and a molecular weight of 413.35 g/mol. Its IUPAC name is [4-[(2,3,4,5,6-pentafluorophenyl)carbamothioylamino]phenyl]sulfamic acid.
| Compound Name | [4-[(2,3,4,5,6-pentafluorophenyl)carbamothioylamino]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 89416726 |
| Molecular Formula | C13H8F5N3O3S2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | [4-[(2,3,4,5,6-pentafluorophenyl)carbamothioylamino]phenyl]sulfamic acid |
| SMILES | O=S(=O)(O)Nc1ccc(NC(=S)Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H8F5N3O3S2/c14-7-8(15)10(17)12(11(18)9(7)16)20-13(25)19-5-1-3-6(4-2-5)21-26(22,23)24/h1-4,21H,(H2,19,20,25)(H,22,23,24) |
| InChIKey | XZKCCARTAWXGRV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|