C14H12F2N2O2S2 — CID 53488936
1-(3,5-difluorophenyl)-3-(4-methylsulfonylphenyl)thiourea (PubChem CID 53488936) has the molecular formula C14H12F2N2O2S2 and a molecular weight of 342.39 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-(4-methylsulfonylphenyl)thiourea.
| Compound Name | 1-(3,5-difluorophenyl)-3-(4-methylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 53488936 |
| Molecular Formula | C14H12F2N2O2S2 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-(4-methylsulfonylphenyl)thiourea |
| SMILES | CS(=O)(=O)c1ccc(NC(=S)Nc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C14H12F2N2O2S2/c1-22(19,20)13-4-2-11(3-5-13)17-14(21)18-12-7-9(15)6-10(16)8-12/h2-8H,1H3,(H2,17,18,21) |
| InChIKey | PIVPYGLKZARMDO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|