C15H14ClFN4O3S2 — CID 2210659
1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(4-sulfamoylphenyl)thiourea (PubChem CID 2210659) has the molecular formula C15H14ClFN4O3S2 and a molecular weight of 416.89 g/mol. Its IUPAC name is 1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(4-sulfamoylphenyl)thiourea.
| Compound Name | 1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 2210659 |
| Molecular Formula | C15H14ClFN4O3S2 |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 1-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]-3-(4-sulfamoylphenyl)thiourea |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NNC(=O)Cc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C15H14ClFN4O3S2/c16-12-2-1-3-13(17)11(12)8-14(22)20-21-15(25)19-9-4-6-10(7-5-9)26(18,23)24/h1-7H,8H2,(H,20,22)(H2,18,23,24)(H2,19,21,25) |
| InChIKey | JTRBKNSCZWPRNF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|