C14H15N5O3S2 — CID 141091720
N-[[2-(4-sulfamoylphenyl)hydrazinyl]carbamothioyl]benzamide (PubChem CID 141091720) has the molecular formula C14H15N5O3S2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[[2-(4-sulfamoylphenyl)hydrazinyl]carbamothioyl]benzamide.
| Compound Name | N-[[2-(4-sulfamoylphenyl)hydrazinyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 141091720 |
| Molecular Formula | C14H15N5O3S2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | N-[[2-(4-sulfamoylphenyl)hydrazinyl]carbamothioyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(NNNC(=S)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N5O3S2/c15-24(21,22)12-8-6-11(7-9-12)17-19-18-14(23)16-13(20)10-4-2-1-3-5-10/h1-9,17,19H,(H2,15,21,22)(H2,16,18,20,23) |
| InChIKey | ZGVZVMCNTGMDLK-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|