C4H8BrN5O3S2 — CID 15041395
[2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]azanium bromide (PubChem CID 15041395) has the molecular formula C4H8BrN5O3S2 and a molecular weight of 318.18 g/mol. Its IUPAC name is [2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]azanium bromide.
| Compound Name | [2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]azanium bromide |
|---|---|
| PubChem CID | 15041395 |
| Molecular Formula | C4H8BrN5O3S2 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | [2-oxo-2-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]ethyl]azanium bromide |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)C[NH3+])s1.[Br-] |
| InChI | InChI=1S/C4H7N5O3S2.BrH/c5-1-2(10)7-3-8-9-4(13-3)14(6,11)12;/h1,5H2,(H2,6,11,12)(H,7,8,10);1H |
| InChIKey | YBEUTHKGWSOAAT-UHFFFAOYSA-N |
| XLogP | -5.63 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|