C3H4N4O3S3 — CID 123430728
(5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamothioic S-acid (PubChem CID 123430728) has the molecular formula C3H4N4O3S3 and a molecular weight of 240.29 g/mol. Its IUPAC name is (5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamothioic S-acid.
| Compound Name | (5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamothioic S-acid |
|---|---|
| PubChem CID | 123430728 |
| Molecular Formula | C3H4N4O3S3 |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 239.94 |
| IUPAC Name | (5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamothioic S-acid |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)S)s1 |
| InChI | InChI=1S/C3H4N4O3S3/c4-13(9,10)3-7-6-1(12-3)5-2(8)11/h(H2,4,9,10)(H2,5,6,8,11) |
| InChIKey | KJSVZMNWTWSKDB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|