C6H8F3N5O5S3 — CID 10833817
N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethylsulfonylamino)propanamide (PubChem CID 10833817) has the molecular formula C6H8F3N5O5S3 and a molecular weight of 383.36 g/mol. Its IUPAC name is N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethylsulfonylamino)propanamide.
| Compound Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 10833817 |
| Molecular Formula | C6H8F3N5O5S3 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethylsulfonylamino)propanamide |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)CCNS(=O)(=O)C(F)(F)F)s1 |
| InChI | InChI=1S/C6H8F3N5O5S3/c7-6(8,9)22(18,19)11-2-1-3(15)12-4-13-14-5(20-4)21(10,16)17/h11H,1-2H2,(H2,10,16,17)(H,12,13,15) |
| InChIKey | DKDNNTGJSLIDOQ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|