C9H11N5O5S4 — CID 101078071
N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 101078071) has the molecular formula C9H11N5O5S4 and a molecular weight of 397.49 g/mol. Its IUPAC name is N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 101078071 |
| Molecular Formula | C9H11N5O5S4 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)-3-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)CCNS(=O)(=O)c2cccs2)s1 |
| InChI | InChI=1S/C9H11N5O5S4/c10-22(16,17)9-14-13-8(21-9)12-6(15)3-4-11-23(18,19)7-2-1-5-20-7/h1-2,5,11H,3-4H2,(H2,10,16,17)(H,12,13,15) |
| InChIKey | JATKMQBYVRTFQN-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|