C12H21N5O5S2 — CID 178065843
methyl N-[8-oxo-8-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]octyl]carbamate (PubChem CID 178065843) has the molecular formula C12H21N5O5S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl N-[8-oxo-8-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]octyl]carbamate.
| Compound Name | methyl N-[8-oxo-8-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]octyl]carbamate |
|---|---|
| PubChem CID | 178065843 |
| Molecular Formula | C12H21N5O5S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | methyl N-[8-oxo-8-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]octyl]carbamate |
| SMILES | COC(=O)NCCCCCCCC(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C12H21N5O5S2/c1-22-11(19)14-8-6-4-2-3-5-7-9(18)15-10-16-17-12(23-10)24(13,20)21/h2-8H2,1H3,(H,14,19)(H2,13,20,21)(H,15,16,18) |
| InChIKey | SCVPGODYKKBEGG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|