C9H16N8O4S2 — CID 10594934
3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 10594934) has the molecular formula C9H16N8O4S2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 10594934 |
| Molecular Formula | C9H16N8O4S2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-[[2-[carbamimidoyl(methyl)amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | [H]/N=C(\N)N(C)CC(=O)NCCC(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C9H16N8O4S2/c1-17(7(10)11)4-6(19)13-3-2-5(18)14-8-15-16-9(22-8)23(12,20)21/h2-4H2,1H3,(H3,10,11)(H,13,19)(H2,12,20,21)(H,14,15,18) |
| InChIKey | DCHWBJNKHKXUAM-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 197.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|