C28H30N8O4S3 — CID 23228694
3-[[2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 23228694) has the molecular formula C28H30N8O4S3 and a molecular weight of 638.80 g/mol. Its IUPAC name is 3-[[2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-[[2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 23228694 |
| Molecular Formula | C28H30N8O4S3 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.16 |
| IUPAC Name | 3-[[2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]acetyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CN(CC(=O)NCCC(=O)Nc1nnc(S(N)(=O)=O)s1)/C(N)=N/SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N8O4S3/c1-36(19-24(38)31-18-17-23(37)32-26-33-34-27(41-26)43(30,39)40)25(29)35-42-28(20-11-5-2-6-12-20,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16H,17-19H2,1H3,(H2,29,35)(H,31,38)(H2,30,39,40)(H,32,33,37) |
| InChIKey | LDOJOZCZFDRRND-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 185.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|