C25H25N7O3S3 — CID 10578927
2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 10578927) has the molecular formula C25H25N7O3S3 and a molecular weight of 567.72 g/mol. Its IUPAC name is 2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 10578927 |
| Molecular Formula | C25H25N7O3S3 |
| Molecular Weight | 567.72 g/mol |
| Exact Mass | 567.12 |
| IUPAC Name | 2-[methyl-[(E)-N'-tritylsulfanylcarbamimidoyl]amino]-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CN(CC(=O)Nc1nnc(S(N)(=O)=O)s1)/C(N)=N/SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N7O3S3/c1-32(17-21(33)28-23-29-30-24(36-23)38(27,34)35)22(26)31-37-25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,17H2,1H3,(H2,26,31)(H2,27,34,35)(H,28,29,33) |
| InChIKey | CKYXMCIPVBNIOT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|