C17H23N7O6S2 — CID 70828588
2-[2-[[2-oxo-2-[[(2S)-1-oxo-3-phenyl-1-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]amino]ethyl]amino]ethylamino]acetic acid (PubChem CID 70828588) has the molecular formula C17H23N7O6S2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 2-[2-[[2-oxo-2-[[(2S)-1-oxo-3-phenyl-1-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]amino]ethyl]amino]ethylamino]acetic acid.
| Compound Name | 2-[2-[[2-oxo-2-[[(2S)-1-oxo-3-phenyl-1-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]amino]ethyl]amino]ethylamino]acetic acid |
|---|---|
| PubChem CID | 70828588 |
| Molecular Formula | C17H23N7O6S2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-[2-[[2-oxo-2-[[(2S)-1-oxo-3-phenyl-1-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]amino]ethyl]amino]ethylamino]acetic acid |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)[C@H](Cc2ccccc2)NC(=O)CNCCNCC(=O)O)s1 |
| InChI | InChI=1S/C17H23N7O6S2/c18-32(29,30)17-24-23-16(31-17)22-15(28)12(8-11-4-2-1-3-5-11)21-13(25)9-19-6-7-20-10-14(26)27/h1-5,12,19-20H,6-10H2,(H,21,25)(H,26,27)(H2,18,29,30)(H,22,23,28)/t12-/m0/s1 |
| InChIKey | SVLHKTGADNWVMB-LBPRGKRZSA-N |
| XLogP | -1.88 |
| TPSA | 205.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|