C14H14N6O5S2 — CID 130431642
3-[(2S)-2-amino-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid (PubChem CID 130431642) has the molecular formula C14H14N6O5S2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-[(2S)-2-amino-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid.
| Compound Name | 3-[(2S)-2-amino-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 130431642 |
| Molecular Formula | C14H14N6O5S2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 3-[(2S)-2-amino-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid |
| SMILES | N[C@@H](Cc1cn(C(=O)O)c2ccccc12)C(=O)Nc1nnc(S(N)(=O)=O)s1 |
| InChI | InChI=1S/C14H14N6O5S2/c15-9(11(21)17-12-18-19-13(26-12)27(16,24)25)5-7-6-20(14(22)23)10-4-2-1-3-8(7)10/h1-4,6,9H,5,15H2,(H,22,23)(H2,16,24,25)(H,17,18,21)/t9-/m0/s1 |
| InChIKey | GQLLIQTXOXKDNR-VIFPVBQESA-N |
| XLogP | 0.17 |
| TPSA | 183.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|