C14H17N3O4 — CID 57125720
(2S)-2-amino-3-[1-[(2S)-2-amino-3-hydroxypropanoyl]indol-3-yl]propanoic acid (PubChem CID 57125720) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2S)-2-amino-3-[1-[(2S)-2-amino-3-hydroxypropanoyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[1-[(2S)-2-amino-3-hydroxypropanoyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57125720 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (2S)-2-amino-3-[1-[(2S)-2-amino-3-hydroxypropanoyl]indol-3-yl]propanoic acid |
| SMILES | N[C@@H](Cc1cn(C(=O)[C@@H](N)CO)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H17N3O4/c15-10(14(20)21)5-8-6-17(13(19)11(16)7-18)12-4-2-1-3-9(8)12/h1-4,6,10-11,18H,5,7,15-16H2,(H,20,21)/t10-,11-/m0/s1 |
| InChIKey | XLZWOCFHJAGNTO-QWRGUYRKSA-N |
| XLogP | -0.44 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |