C14H19N3O5S — CID 175012542
(2S)-2-amino-3-[1-[2-hydroxy-2-(methanesulfonamido)ethyl]indol-3-yl]propanoic acid (PubChem CID 175012542) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is (2S)-2-amino-3-[1-[2-hydroxy-2-(methanesulfonamido)ethyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[1-[2-hydroxy-2-(methanesulfonamido)ethyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 175012542 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (2S)-2-amino-3-[1-[2-hydroxy-2-(methanesulfonamido)ethyl]indol-3-yl]propanoic acid |
| SMILES | CS(=O)(=O)NC(O)Cn1cc(C[C@H](N)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C14H19N3O5S/c1-23(21,22)16-13(18)8-17-7-9(6-11(15)14(19)20)10-4-2-3-5-12(10)17/h2-5,7,11,13,16,18H,6,8,15H2,1H3,(H,19,20)/t11-,13?/m0/s1 |
| InChIKey | YEOZJEGGFLMUOT-AMGKYWFPSA-N |
| XLogP | -0.54 |
| TPSA | 134.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|