C16H19N3O5 — CID 91291843
(4S)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]indol-1-yl]-5-oxopentanoic acid (PubChem CID 91291843) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is (4S)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]indol-1-yl]-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]indol-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91291843 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (4S)-4-amino-5-[3-[(2R)-2-amino-2-carboxyethyl]indol-1-yl]-5-oxopentanoic acid |
| SMILES | N[C@H](Cc1cn(C(=O)[C@@H](N)CCC(=O)O)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H19N3O5/c17-11(5-6-14(20)21)15(22)19-8-9(7-12(18)16(23)24)10-3-1-2-4-13(10)19/h1-4,8,11-12H,5-7,17-18H2,(H,20,21)(H,23,24)/t11-,12+/m0/s1 |
| InChIKey | BSKHIQVAIJSULQ-NWDGAFQWSA-N |
| XLogP | 0.43 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |