C15H21N3O4S — CID 88609118
3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2R)-2-amino-3-sulfanylpropanoic acid (PubChem CID 88609118) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2R)-2-amino-3-sulfanylpropanoic acid.
| Compound Name | 3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 88609118 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
| SMILES | C[C@@H](N)Cc1cn(C(=O)O)c2ccccc12.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C12H14N2O2.C3H7NO2S/c1-8(13)6-9-7-14(12(15)16)11-5-3-2-4-10(9)11;4-2(1-7)3(5)6/h2-5,7-8H,6,13H2,1H3,(H,15,16);2,7H,1,4H2,(H,5,6)/t8-;2-/m10/s1 |
| InChIKey | BTBXCKWQRWFXGF-VMESBRQFSA-N |
| XLogP | 1.39 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|