C16H20N2O3S2 — CID 57245447
3-[(2R)-2-[[3-sulfanyl-2-(sulfanylmethyl)propanoyl]amino]propyl]indole-1-carboxylic acid (PubChem CID 57245447) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[(2R)-2-[[3-sulfanyl-2-(sulfanylmethyl)propanoyl]amino]propyl]indole-1-carboxylic acid.
| Compound Name | 3-[(2R)-2-[[3-sulfanyl-2-(sulfanylmethyl)propanoyl]amino]propyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 57245447 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-[(2R)-2-[[3-sulfanyl-2-(sulfanylmethyl)propanoyl]amino]propyl]indole-1-carboxylic acid |
| SMILES | C[C@H](Cc1cn(C(=O)O)c2ccccc12)NC(=O)C(CS)CS |
| InChI | InChI=1S/C16H20N2O3S2/c1-10(17-15(19)12(8-22)9-23)6-11-7-18(16(20)21)14-5-3-2-4-13(11)14/h2-5,7,10,12,22-23H,6,8-9H2,1H3,(H,17,19)(H,20,21)/t10-/m1/s1 |
| InChIKey | BKNLGQGUEFJMQU-SNVBAGLBSA-N |
| XLogP | 2.69 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|