C16H23N3O4 — CID 90205467
3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2S)-2-(methylamino)propanoic acid (PubChem CID 90205467) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2S)-2-(methylamino)propanoic acid.
| Compound Name | 3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2S)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 90205467 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-[(2R)-2-aminopropyl]indole-1-carboxylic acid;(2S)-2-(methylamino)propanoic acid |
| SMILES | CN[C@@H](C)C(=O)O.C[C@@H](N)Cc1cn(C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C12H14N2O2.C4H9NO2/c1-8(13)6-9-7-14(12(15)16)11-5-3-2-4-10(9)11;1-3(5-2)4(6)7/h2-5,7-8H,6,13H2,1H3,(H,15,16);3,5H,1-2H3,(H,6,7)/t8-;3-/m10/s1 |
| InChIKey | ALNMRGYOUULNEG-QTBHSTJXSA-N |
| XLogP | 1.74 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |