About (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate
(2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate (PubChem CID 173274623) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate.
Molecular Properties
| Compound Name | (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate |
| PubChem CID | 173274623 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate |
| SMILES | C[C@@H](N)Cc1cn(C(=O)OC(=O)CN)c2ccccc12 |
| InChI | InChI=1S/C14H17N3O3/c1-9(16)6-10-8-17(14(19)20-13(18)7-15)12-5-3-2-4-11(10)12/h2-5,8-9H,6-7,15-16H2,1H3/t9-/m1/s1 |
| InChIKey | MTOFLNXNEHVHNA-SECBINFHSA-N |
| XLogP | 1.00 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate?
The IUPAC name of (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate (CID 173274623) is (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate.
What is the SMILES notation for (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate?
The canonical SMILES for (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate is C[C@@H](N)Cc1cn(C(=O)OC(=O)CN)c2ccccc12.
What is the InChIKey of (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate?
The InChIKey is MTOFLNXNEHVHNA-SECBINFHSA-N. The full InChI is InChI=1S/C14H17N3O3/c1-9(16)6-10-8-17(14(19)20-13(18)7-15)12-5-3-2-4-11(10)12/h2-5,8-9H,6-7,15-16H2,1H3/t9-/m1/s1.
What are the key properties of (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate?
(2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate has a molecular weight of 275.31 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoacetyl) 3-[(2R)-2-aminopropyl]indole-1-carboxylate is sourced from PubChem (CID 173274623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).