C28H36N3O4P — CID 57102724
3-[(2R)-2-[[(2S)-4-methyl-2-[4-phenylbutyl(phosphoroso)amino]pentanoyl]amino]propyl]indole-1-carboxylic acid (PubChem CID 57102724) has the molecular formula C28H36N3O4P and a molecular weight of 509.59 g/mol. Its IUPAC name is 3-[(2R)-2-[[(2S)-4-methyl-2-[4-phenylbutyl(phosphoroso)amino]pentanoyl]amino]propyl]indole-1-carboxylic acid.
| Compound Name | 3-[(2R)-2-[[(2S)-4-methyl-2-[4-phenylbutyl(phosphoroso)amino]pentanoyl]amino]propyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 57102724 |
| Molecular Formula | C28H36N3O4P |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 3-[(2R)-2-[[(2S)-4-methyl-2-[4-phenylbutyl(phosphoroso)amino]pentanoyl]amino]propyl]indole-1-carboxylic acid |
| SMILES | CC(C)C[C@@H](C(=O)N[C@H](C)Cc1cn(C(=O)O)c2ccccc12)N(CCCCc1ccccc1)P=O |
| InChI | InChI=1S/C28H36N3O4P/c1-20(2)17-26(31(36-35)16-10-9-13-22-11-5-4-6-12-22)27(32)29-21(3)18-23-19-30(28(33)34)25-15-8-7-14-24(23)25/h4-8,11-12,14-15,19-21,26H,9-10,13,16-18H2,1-3H3,(H,29,32)(H,33,34)/t21-,26+/m1/s1 |
| InChIKey | PCSHBOBCKCSTLF-RLWLMLJZSA-N |
| XLogP | 6.16 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|