C29H24N6O7S2 — CID 130431682
3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid (PubChem CID 130431682) has the molecular formula C29H24N6O7S2 and a molecular weight of 632.68 g/mol. Its IUPAC name is 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid.
| Compound Name | 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid |
|---|---|
| PubChem CID | 130431682 |
| Molecular Formula | C29H24N6O7S2 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.11 |
| IUPAC Name | 3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-oxo-3-[(5-sulfamoyl-1,3,4-thiadiazol-2-yl)amino]propyl]indole-1-carboxylic acid |
| SMILES | NS(=O)(=O)c1nnc(NC(=O)C(Cc2cn(C(=O)O)c3ccccc23)NC(=O)OCC2c3ccccc3-c3ccccc32)s1 |
| InChI | InChI=1S/C29H24N6O7S2/c30-44(40,41)28-34-33-26(43-28)32-25(36)23(13-16-14-35(29(38)39)24-12-6-5-7-17(16)24)31-27(37)42-15-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-12,14,22-23H,13,15H2,(H,31,37)(H,38,39)(H2,30,40,41)(H,32,33,36) |
| InChIKey | YBBNAUXOHGEWHC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|