C29H26N2O7S — CID 175525210
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(2-methylsulfonyl-2-oxoethyl)indol-3-yl]propanoic acid (PubChem CID 175525210) has the molecular formula C29H26N2O7S and a molecular weight of 546.60 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(2-methylsulfonyl-2-oxoethyl)indol-3-yl]propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(2-methylsulfonyl-2-oxoethyl)indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 175525210 |
| Molecular Formula | C29H26N2O7S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-(2-methylsulfonyl-2-oxoethyl)indol-3-yl]propanoic acid |
| SMILES | CS(=O)(=O)C(=O)Cn1cc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C29H26N2O7S/c1-39(36,37)27(32)16-31-15-18(19-8-6-7-13-26(19)31)14-25(28(33)34)30-29(35)38-17-24-22-11-4-2-9-20(22)21-10-3-5-12-23(21)24/h2-13,15,24-25H,14,16-17H2,1H3,(H,30,35)(H,33,34) |
| InChIKey | KEFHOQVRKJCZCG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|